ChemNet > CAS > 3541-37-5 Benzo[b]thiophene-2-carboxaldehyde
3541-37-5 Benzo[b]thiophene-2-carboxaldehyde
Ürün Adı |
Benzo[b]thiophene-2-carboxaldehyde |
ingilizce adı |
Benzo[b]thiophene-2-carboxaldehyde; 2-Formylbenzo[b]thiophene; Thianaphthene-2-carboxaldehyde; 1-Benzothiophene-2-carbaldehyde; Benzo[b]thiophene-2-carbaldehyde |
Moleküler Formülü |
C9H6OS |
Molekül Ağırlığı |
162.2083 |
InChI |
InChI=1/C9H6OS/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-6H |
CAS kayıt numarası |
3541-37-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.3g/cm3 |
Ergime noktası |
32-36℃ |
Kaynama noktası |
303.2°C at 760 mmHg |
Kırılma indisi |
1.719 |
Alevlenme noktası |
137.2°C |
Buhar basıncı |
0.000944mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S22:;
S24/25:;
|
|